C26H48O4Si — CID 175882118
[(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 175882118) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is [(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 175882118 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | [(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=CC[C@H]1C=C[C@H](OCOC)[C@H](/C(C)=C/[C@@H](C)[C@@H](C)O[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C26H48O4Si/c1-12-13-24-14-15-25(28-17-27-11)26(29-24)22(9)16-21(8)23(10)30-31(18(2)3,19(4)5)20(6)7/h12,14-16,18-21,23-26H,1,13,17H2,2-11H3/b22-16+/t21-,23-,24+,25+,26+/m1/s1 |
| InChIKey | HTHPRUGMISYPMA-SVXHLEKWSA-N |
| XLogP | 7.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|