C23H42O4Si — CID 175882120
tert-butyl-[(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-dimethylsilane (PubChem CID 175882120) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 175882120 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | tert-butyl-[(E,2R,3R)-5-[(2S,3S,6S)-3-(methoxymethoxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]-3-methylhex-4-en-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H]1C=C[C@H](OCOC)[C@H](/C(C)=C/[C@@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H42O4Si/c1-11-12-20-13-14-21(25-16-24-8)22(26-20)18(3)15-17(2)19(4)27-28(9,10)23(5,6)7/h11,13-15,17,19-22H,1,12,16H2,2-10H3/b18-15+/t17-,19-,20+,21+,22+/m1/s1 |
| InChIKey | CSTWDEPLLZTXNN-IAVPOMCISA-N |
| XLogP | 5.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|