C30H17BrO — CID 175882169
1-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran (PubChem CID 175882169) has the molecular formula C30H17BrO and a molecular weight of 481.42 g/mol. Its IUPAC name is 1-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran.
| Compound Name | 1-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 175882169 |
| Molecular Formula | C30H17BrO |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 1-(10-bromo-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl)naphtho[2,3-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4oc5cc6ccccc6cc5c34)c3c([2H])c([2H])c([2H])c([2H])c3c(Br)c2c1[2H] |
| InChI | InChI=1S/C30H17BrO/c31-30-22-12-5-3-10-20(22)28(21-11-4-6-13-23(21)30)24-14-7-15-26-29(24)25-16-18-8-1-2-9-19(18)17-27(25)32-26/h1-17H/i3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | TZWCMIFQTCYONZ-RYVHBELGSA-N |
| XLogP | 9.48 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|