About 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol
2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 175882443) has the molecular formula C8H10F2O
and a molecular weight of 160.16 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 175882443 |
| Molecular Formula | C8H10F2O |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | OCCC1=CCC(F)(F)C=C1 |
| InChI | InChI=1S/C8H10F2O/c9-8(10)4-1-7(2-5-8)3-6-11/h1-2,4,11H,3,5-6H2 |
| InChIKey | HFQLJIMZOPVREV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol (CID 175882443) is 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol is OCCC1=CCC(F)(F)C=C1.
What is the InChIKey of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is HFQLJIMZOPVREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O/c9-8(10)4-1-7(2-5-8)3-6-11/h1-2,4,11H,3,5-6H2.
What are the key properties of 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol?
2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 160.16 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 175882443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).