About (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol
(2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol (PubChem CID 175882551) has the molecular formula C25H40O2
and a molecular weight of 372.59 g/mol. Its IUPAC name is (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol.
Molecular Properties
| Compound Name | (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol |
| PubChem CID | 175882551 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC[C@@H]1C=Cc2cc(O)ccc2O1 |
| InChI | InChI=1S/C25H40O2/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-24-16-14-22-18-23(26)15-17-25(22)27-24/h14-21,24,26H,5-13H2,1-4H3/t20?,21?,24-/m1/s1 |
| InChIKey | OOTONYMTLRLMTJ-SLXFGWRHSA-N |
| XLogP | 7.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol?
The IUPAC name of (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol (CID 175882551) is (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol.
What is the SMILES notation for (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol?
The canonical SMILES for (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol is CC(C)CCCC(C)CCCC(C)CCC[C@@H]1C=Cc2cc(O)ccc2O1.
What is the InChIKey of (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol?
The InChIKey is OOTONYMTLRLMTJ-SLXFGWRHSA-N. The full InChI is InChI=1S/C25H40O2/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-24-16-14-22-18-23(26)15-17-25(22)27-24/h14-21,24,26H,5-13H2,1-4H3/t20?,21?,24-/m1/s1.
What are the key properties of (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol?
(2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol has a molecular weight of 372.59 g/mol, XLogP of 7.61, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4,8,12-trimethyltridecyl)-2H-chromen-6-ol is sourced from PubChem (CID 175882551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).