About 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione
6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione (PubChem CID 175883090) has the molecular formula C8H8N4OS
and a molecular weight of 208.25 g/mol. Its IUPAC name is 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione |
| PubChem CID | 175883090 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(Nc2ccnc(=S)[nH]2)no1 |
| InChI | InChI=1S/C8H8N4OS/c1-5-4-7(12-13-5)10-6-2-3-9-8(14)11-6/h2-4H,1H3,(H2,9,10,11,12,14) |
| InChIKey | SZUAZMMNUGHDNG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione?
The IUPAC name of 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione (CID 175883090) is 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione.
What is the SMILES notation for 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione?
The canonical SMILES for 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione is Cc1cc(Nc2ccnc(=S)[nH]2)no1.
What is the InChIKey of 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione?
The InChIKey is SZUAZMMNUGHDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4OS/c1-5-4-7(12-13-5)10-6-2-3-9-8(14)11-6/h2-4H,1H3,(H2,9,10,11,12,14).
What are the key properties of 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione?
6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione has a molecular weight of 208.25 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-methyl-1,2-oxazol-3-yl)amino]-1H-pyrimidine-2-thione is sourced from PubChem (CID 175883090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).