C20H33NO2 — CID 175883460
1-[[4-(2-propoxyphenyl)butan-2-ylamino]methyl]cyclohexan-1-ol (PubChem CID 175883460) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-[[4-(2-propoxyphenyl)butan-2-ylamino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[4-(2-propoxyphenyl)butan-2-ylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 175883460 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-[[4-(2-propoxyphenyl)butan-2-ylamino]methyl]cyclohexan-1-ol |
| SMILES | CCCOc1ccccc1CCC(C)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C20H33NO2/c1-3-15-23-19-10-6-5-9-18(19)12-11-17(2)21-16-20(22)13-7-4-8-14-20/h5-6,9-10,17,21-22H,3-4,7-8,11-16H2,1-2H3 |
| InChIKey | XAFJRULBVHPBHT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |