C17H15N5O4S — CID 175883463
4-azido-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxy-6-phenylpyridine-3-carboxamide (PubChem CID 175883463) has the molecular formula C17H15N5O4S and a molecular weight of 385.41 g/mol. Its IUPAC name is 4-azido-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxy-6-phenylpyridine-3-carboxamide.
| Compound Name | 4-azido-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxy-6-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 175883463 |
| Molecular Formula | C17H15N5O4S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-azido-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxy-6-phenylpyridine-3-carboxamide |
| SMILES | COc1nc(-c2ccccc2)cc(N=[N+]=[N-])c1C(=O)N[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C17H15N5O4S/c1-26-17-15(16(23)19-12-7-8-27(24,25)10-12)14(21-22-18)9-13(20-17)11-5-3-2-4-6-11/h2-9,12H,10H2,1H3,(H,19,23)/t12-/m1/s1 |
| InChIKey | WXNAMSVQTPPLMY-GFCCVEGCSA-N |
| XLogP | 2.74 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|