C12H22N4 — CID 175883554
azane;2,3,4-trideuterio-1,2,4-tris(prop-2-enyl)-1,3,5-triazine (PubChem CID 175883554) has the molecular formula C12H22N4 and a molecular weight of 225.35 g/mol. Its IUPAC name is azane;2,3,4-trideuterio-1,2,4-tris(prop-2-enyl)-1,3,5-triazine.
| Compound Name | azane;2,3,4-trideuterio-1,2,4-tris(prop-2-enyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 175883554 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | azane;2,3,4-trideuterio-1,2,4-tris(prop-2-enyl)-1,3,5-triazine |
| SMILES | N.[2H]N1C([2H])(CC=C)N=CN(CC=C)C1([2H])CC=C |
| InChI | InChI=1S/C12H19N3.H3N/c1-4-7-11-13-10-15(9-6-3)12(14-11)8-5-2;/h4-6,10-12,14H,1-3,7-9H2;1H3/i11D,12D;/hD |
| InChIKey | DALVAPJAWYULQN-HUXPTLDMSA-N |
| XLogP | 2.07 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|