C31H32F3N5O4 — CID 175883563
18-(cyclohexen-1-yl)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene (PubChem CID 175883563) has the molecular formula C31H32F3N5O4 and a molecular weight of 595.62 g/mol. Its IUPAC name is 18-(cyclohexen-1-yl)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene.
| Compound Name | 18-(cyclohexen-1-yl)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene |
|---|---|
| PubChem CID | 175883563 |
| Molecular Formula | C31H32F3N5O4 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 18-(cyclohexen-1-yl)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene |
| SMILES | O=[N+]([O-])c1cc(C2=CCCCC2)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CCC=CCC1CCCN21 |
| InChI | InChI=1S/C31H32F3N5O4/c32-31(33,34)30(42-20-21-11-4-1-5-12-21)17-9-3-8-15-23-16-10-18-38(23)27-24(22-13-6-2-7-14-22)19-25(39(40)41)26(35-27)28-36-37-29(30)43-28/h1,3-5,8,11-13,19,23H,2,6-7,9-10,14-18,20H2 |
| InChIKey | JXGMYJUITWRFJL-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 107.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|