About (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate
(propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate (PubChem CID 175883846) has the molecular formula C6H13NS4
and a molecular weight of 227.44 g/mol. Its IUPAC name is (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate |
| PubChem CID | 175883846 |
| Molecular Formula | C6H13NS4 |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate |
| SMILES | CC(C)SSSC(=S)N(C)C |
| InChI | InChI=1S/C6H13NS4/c1-5(2)9-11-10-6(8)7(3)4/h5H,1-4H3 |
| InChIKey | DBZLBZQOABKRCT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate?
The IUPAC name of (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate (CID 175883846) is (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate.
What is the SMILES notation for (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate?
The canonical SMILES for (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate is CC(C)SSSC(=S)N(C)C.
What is the InChIKey of (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate?
The InChIKey is DBZLBZQOABKRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS4/c1-5(2)9-11-10-6(8)7(3)4/h5H,1-4H3.
What are the key properties of (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate?
(propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate has a molecular weight of 227.44 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-yldisulfanyl) N,N-dimethylcarbamodithioate is sourced from PubChem (CID 175883846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).