C15H29N3O2 — CID 175884654
2-[2-(1-octyltriazol-4-yl)ethyl]propane-1,3-diol (PubChem CID 175884654) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-[2-(1-octyltriazol-4-yl)ethyl]propane-1,3-diol.
| Compound Name | 2-[2-(1-octyltriazol-4-yl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 175884654 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2-[2-(1-octyltriazol-4-yl)ethyl]propane-1,3-diol |
| SMILES | CCCCCCCCn1cc(CCC(CO)CO)nn1 |
| InChI | InChI=1S/C15H29N3O2/c1-2-3-4-5-6-7-10-18-11-15(16-17-18)9-8-14(12-19)13-20/h11,14,19-20H,2-10,12-13H2,1H3 |
| InChIKey | MCIMYKGTRPXQIH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|