About 1-ethyl-4H-pyridine-2,3-dione
1-ethyl-4H-pyridine-2,3-dione (PubChem CID 175885165) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 1-ethyl-4H-pyridine-2,3-dione.
Molecular Properties
| Compound Name | 1-ethyl-4H-pyridine-2,3-dione |
| PubChem CID | 175885165 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 1-ethyl-4H-pyridine-2,3-dione |
| SMILES | CCN1C=CCC(=O)C1=O |
| InChI | InChI=1S/C7H9NO2/c1-2-8-5-3-4-6(9)7(8)10/h3,5H,2,4H2,1H3 |
| InChIKey | ZLVQCXZKYDXPQS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4H-pyridine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4H-pyridine-2,3-dione?
The IUPAC name of 1-ethyl-4H-pyridine-2,3-dione (CID 175885165) is 1-ethyl-4H-pyridine-2,3-dione.
What is the SMILES notation for 1-ethyl-4H-pyridine-2,3-dione?
The canonical SMILES for 1-ethyl-4H-pyridine-2,3-dione is CCN1C=CCC(=O)C1=O.
What is the InChIKey of 1-ethyl-4H-pyridine-2,3-dione?
The InChIKey is ZLVQCXZKYDXPQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-2-8-5-3-4-6(9)7(8)10/h3,5H,2,4H2,1H3.
What are the key properties of 1-ethyl-4H-pyridine-2,3-dione?
1-ethyl-4H-pyridine-2,3-dione has a molecular weight of 139.15 g/mol, XLogP of 0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4H-pyridine-2,3-dione is sourced from PubChem (CID 175885165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).