C24H25ClN6O2 — CID 175885235
[1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,2,2-trideuterioethyl] 4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-3-yl]piperazine-1-carboxylate (PubChem CID 175885235) has the molecular formula C24H25ClN6O2 and a molecular weight of 472.00 g/mol. Its IUPAC name is [1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,2,2-trideuterioethyl] 4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-3-yl]piperazine-1-carboxylate.
| Compound Name | [1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,2,2-trideuterioethyl] 4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175885235 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 472.00 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [1-(4-chloro-2,3,5,6-tetradeuteriophenyl)-2,2,2-trideuterioethyl] 4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-3-yl]piperazine-1-carboxylate |
| SMILES | [2H]c1c([2H])c(C(OC(=O)N2CCN(c3cnn4cc(-c5cnn(C)c5)ccc34)CC2)C([2H])([2H])[2H])c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C24H25ClN6O2/c1-17(18-3-6-21(25)7-4-18)33-24(32)30-11-9-29(10-12-30)23-14-27-31-16-19(5-8-22(23)31)20-13-26-28(2)15-20/h3-8,13-17H,9-12H2,1-2H3/i1D3,3D,4D,6D,7D |
| InChIKey | CTFRSOYNYGSADH-FFQSSJIFSA-N |
| XLogP | 4.41 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.00 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |