C13H11N3O — CID 175885244
11-methyl-5,7-dihydropyrido[2,3-d][1,3]benzodiazepin-6-one (PubChem CID 175885244) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 11-methyl-5,7-dihydropyrido[2,3-d][1,3]benzodiazepin-6-one.
| Compound Name | 11-methyl-5,7-dihydropyrido[2,3-d][1,3]benzodiazepin-6-one |
|---|---|
| PubChem CID | 175885244 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 11-methyl-5,7-dihydropyrido[2,3-d][1,3]benzodiazepin-6-one |
| SMILES | Cc1cccc2c1-c1cccnc1NC(=O)N2 |
| InChI | InChI=1S/C13H11N3O/c1-8-4-2-6-10-11(8)9-5-3-7-14-12(9)16-13(17)15-10/h2-7H,1H3,(H2,14,15,16,17) |
| InChIKey | BOBBRGQGWNQRGO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |