methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate

C8H8F3NO2 — CID 175885564

IUPACmethyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate
SMILESCOC(=O)N1C=CC=C(C(F)(F)F)C1
InChIInChI=1S/C8H8F3NO2/c1-14-7(13)12-4-2-3-6(5-12)8(9,10)11/h2-4H,5H2,1H3
InChIKeyBMMMDFZSHYZIJY-UHFFFAOYSA-N
MW207.15 g/mol
LogP2.07
Rot. Bonds

About methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate

methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate (PubChem CID 175885564) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate
PubChem CID175885564
Molecular FormulaC8H8F3NO2
Molecular Weight207.15 g/mol
Exact Mass207.05
IUPAC Namemethyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate
SMILESCOC(=O)N1C=CC=C(C(F)(F)F)C1
InChIInChI=1S/C8H8F3NO2/c1-14-7(13)12-4-2-3-6(5-12)8(9,10)11/h2-4H,5H2,1H3
InChIKeyBMMMDFZSHYZIJY-UHFFFAOYSA-N
XLogP2.07
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.15
LogP ≤ 52.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate (CID 175885564) is methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate is COC(=O)N1C=CC=C(C(F)(F)F)C1.
What is the InChIKey of methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate?
The InChIKey is BMMMDFZSHYZIJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO2/c1-14-7(13)12-4-2-3-6(5-12)8(9,10)11/h2-4H,5H2,1H3.
What are the key properties of methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate?
methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate has a molecular weight of 207.15 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(trifluoromethyl)-2H-pyridine-1-carboxylate is sourced from PubChem (CID 175885564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).