About ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+)
ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) (PubChem CID 175885738) has the molecular formula C16H34ClPPd+2
and a molecular weight of 399.30 g/mol. Its IUPAC name is ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+).
Molecular Properties
| Compound Name | ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) |
| PubChem CID | 175885738 |
| Molecular Formula | C16H34ClPPd+2 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) |
| SMILES | CC(C)(C)C(Cl)C(C)(C)P(C(C)(C)C)C(C)(C)C.[Pd+2] |
| InChI | InChI=1S/C16H34ClP.Pd/c1-13(2,3)12(17)16(10,11)18(14(4,5)6)15(7,8)9;/h12H,1-11H3;/q;+2 |
| InChIKey | OBPZOGIELUGVAY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+)?
The IUPAC name of ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) (CID 175885738) is ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+).
What is the SMILES notation for ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+)?
The canonical SMILES for ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) is CC(C)(C)C(Cl)C(C)(C)P(C(C)(C)C)C(C)(C)C.[Pd+2].
What is the InChIKey of ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+)?
The InChIKey is OBPZOGIELUGVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34ClP.Pd/c1-13(2,3)12(17)16(10,11)18(14(4,5)6)15(7,8)9;/h12H,1-11H3;/q;+2.
What are the key properties of ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+)?
ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) has a molecular weight of 399.30 g/mol, XLogP of 6.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl-(3-chloro-2,4,4-trimethylpentan-2-yl)phosphane;palladium(2+) is sourced from PubChem (CID 175885738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).