C11H11N5O — CID 175886273
6-(pyridin-2-ylamino)-N-(trideuteriomethyl)pyridazine-3-carboxamide (PubChem CID 175886273) has the molecular formula C11H11N5O and a molecular weight of 232.26 g/mol. Its IUPAC name is 6-(pyridin-2-ylamino)-N-(trideuteriomethyl)pyridazine-3-carboxamide.
| Compound Name | 6-(pyridin-2-ylamino)-N-(trideuteriomethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175886273 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 6-(pyridin-2-ylamino)-N-(trideuteriomethyl)pyridazine-3-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1ccc(Nc2ccccn2)nn1 |
| InChI | InChI=1S/C11H11N5O/c1-12-11(17)8-5-6-10(16-15-8)14-9-4-2-3-7-13-9/h2-7H,1H3,(H,12,17)(H,13,14,16)/i1D3 |
| InChIKey | MJUJIRLYONAJFP-FIBGUPNXSA-N |
| XLogP | 0.97 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |