C24H47FOSi — CID 175886274
[(3S,6R)-6-[(1R,3aR,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-fluoro-2-methylheptan-2-yl]oxy-triethylsilane (PubChem CID 175886274) has the molecular formula C24H47FOSi and a molecular weight of 398.72 g/mol. Its IUPAC name is [(3S,6R)-6-[(1R,3aR,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-fluoro-2-methylheptan-2-yl]oxy-triethylsilane.
| Compound Name | [(3S,6R)-6-[(1R,3aR,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-fluoro-2-methylheptan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 175886274 |
| Molecular Formula | C24H47FOSi |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | [(3S,6R)-6-[(1R,3aR,7aR)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-fluoro-2-methylheptan-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)[C@@H](F)CC[C@@H](C)[C@H]1CC[C@H]2CCCC[C@]21C |
| InChI | InChI=1S/C24H47FOSi/c1-8-27(9-2,10-3)26-23(5,6)22(25)17-14-19(4)21-16-15-20-13-11-12-18-24(20,21)7/h19-22H,8-18H2,1-7H3/t19-,20-,21-,22+,24-/m1/s1 |
| InChIKey | HBXNQZMNGYKCOO-SWAMLEPWSA-N |
| XLogP | 8.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|