C18H8N8 — CID 175886801
8,9,16,17,18,19,22,23-octazahexacyclo[12.12.0.02,11.05,10.015,20.021,26]hexacosa-1(14),2(11),3,5(10),6,8,12,15(20),16,18,21(26),22,24-tridecaene (PubChem CID 175886801) has the molecular formula C18H8N8 and a molecular weight of 336.32 g/mol. Its IUPAC name is 8,9,16,17,18,19,22,23-octazahexacyclo[12.12.0.02,11.05,10.015,20.021,26]hexacosa-1(14),2(11),3,5(10),6,8,12,15(20),16,18,21(26),22,24-tridecaene.
| Compound Name | 8,9,16,17,18,19,22,23-octazahexacyclo[12.12.0.02,11.05,10.015,20.021,26]hexacosa-1(14),2(11),3,5(10),6,8,12,15(20),16,18,21(26),22,24-tridecaene |
|---|---|
| PubChem CID | 175886801 |
| Molecular Formula | C18H8N8 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 8,9,16,17,18,19,22,23-octazahexacyclo[12.12.0.02,11.05,10.015,20.021,26]hexacosa-1(14),2(11),3,5(10),6,8,12,15(20),16,18,21(26),22,24-tridecaene |
| SMILES | c1cc2ccc3c(ccc4c5nnnnc5c5nnccc5c34)c2nn1 |
| InChI | InChI=1S/C18H8N8/c1-2-10-11(15-9(1)5-7-19-21-15)3-4-12-14(10)13-6-8-20-22-16(13)18-17(12)23-25-26-24-18/h1-8H |
| InChIKey | YJKPLHFPBNOKSY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|