C16H17F3N2O4 — CID 175887350
ethyl 2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylideneamino)acetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxylate (PubChem CID 175887350) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is ethyl 2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylideneamino)acetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxylate.
| Compound Name | ethyl 2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylideneamino)acetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 175887350 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl 2-methyl-3-[2-oxo-2-(1,1,1-trifluoropropan-2-ylideneamino)acetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)C(=O)/N=C(\C)C(F)(F)F)n2c1CCC2 |
| InChI | InChI=1S/C16H17F3N2O4/c1-4-25-15(24)11-8(2)12(21-7-5-6-10(11)21)13(22)14(23)20-9(3)16(17,18)19/h4-7H2,1-3H3/b20-9+ |
| InChIKey | VBEFNFYWISYVGP-AWQFTUOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|