About 1-azaspiro[2.5]octane-4,6-dione
1-azaspiro[2.5]octane-4,6-dione (PubChem CID 175887547) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 1-azaspiro[2.5]octane-4,6-dione.
Molecular Properties
| Compound Name | 1-azaspiro[2.5]octane-4,6-dione |
| PubChem CID | 175887547 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 1-azaspiro[2.5]octane-4,6-dione |
| SMILES | O=C1CCC2(CN2)C(=O)C1 |
| InChI | InChI=1S/C7H9NO2/c9-5-1-2-7(4-8-7)6(10)3-5/h8H,1-4H2 |
| InChIKey | OPMGSSYZRNONIS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 56.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-azaspiro[2.5]octane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azaspiro[2.5]octane-4,6-dione?
The IUPAC name of 1-azaspiro[2.5]octane-4,6-dione (CID 175887547) is 1-azaspiro[2.5]octane-4,6-dione.
What is the SMILES notation for 1-azaspiro[2.5]octane-4,6-dione?
The canonical SMILES for 1-azaspiro[2.5]octane-4,6-dione is O=C1CCC2(CN2)C(=O)C1.
What is the InChIKey of 1-azaspiro[2.5]octane-4,6-dione?
The InChIKey is OPMGSSYZRNONIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-5-1-2-7(4-8-7)6(10)3-5/h8H,1-4H2.
What are the key properties of 1-azaspiro[2.5]octane-4,6-dione?
1-azaspiro[2.5]octane-4,6-dione has a molecular weight of 139.15 g/mol, XLogP of -0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azaspiro[2.5]octane-4,6-dione is sourced from PubChem (CID 175887547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).