C15H21N7O3 — CID 175887691
1-hydroxy-2-[(1S,3S)-3-[[5-(3-methyl-2,4-dioxoimidazolidin-1-yl)-2-pyridinyl]amino]cyclopentyl]guanidine (PubChem CID 175887691) has the molecular formula C15H21N7O3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-hydroxy-2-[(1S,3S)-3-[[5-(3-methyl-2,4-dioxoimidazolidin-1-yl)-2-pyridinyl]amino]cyclopentyl]guanidine.
| Compound Name | 1-hydroxy-2-[(1S,3S)-3-[[5-(3-methyl-2,4-dioxoimidazolidin-1-yl)-2-pyridinyl]amino]cyclopentyl]guanidine |
|---|---|
| PubChem CID | 175887691 |
| Molecular Formula | C15H21N7O3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-hydroxy-2-[(1S,3S)-3-[[5-(3-methyl-2,4-dioxoimidazolidin-1-yl)-2-pyridinyl]amino]cyclopentyl]guanidine |
| SMILES | CN1C(=O)CN(c2ccc(N[C@H]3CC[C@H](/N=C(\N)NO)C3)nc2)C1=O |
| InChI | InChI=1S/C15H21N7O3/c1-21-13(23)8-22(15(21)24)11-4-5-12(17-7-11)18-9-2-3-10(6-9)19-14(16)20-25/h4-5,7,9-10,25H,2-3,6,8H2,1H3,(H,17,18)(H3,16,19,20)/t9-,10-/m0/s1 |
| InChIKey | IEYUCYLOKVCKMS-UWVGGRQHSA-N |
| XLogP | 0.11 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|