About 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol
2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol (PubChem CID 175888077) has the molecular formula C11H24O2Si
and a molecular weight of 216.40 g/mol. Its IUPAC name is 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol.
Molecular Properties
| Compound Name | 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol |
| PubChem CID | 175888077 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol |
| SMILES | CC(C)(O)C(C)(O)CC=C[Si](C)(C)C |
| InChI | InChI=1S/C11H24O2Si/c1-10(2,12)11(3,13)8-7-9-14(4,5)6/h7,9,12-13H,8H2,1-6H3 |
| InChIKey | ZWDOOSKYIRHRTJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol?
The IUPAC name of 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol (CID 175888077) is 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol.
What is the SMILES notation for 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol?
The canonical SMILES for 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol is CC(C)(O)C(C)(O)CC=C[Si](C)(C)C.
What is the InChIKey of 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol?
The InChIKey is ZWDOOSKYIRHRTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2Si/c1-10(2,12)11(3,13)8-7-9-14(4,5)6/h7,9,12-13H,8H2,1-6H3.
What are the key properties of 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol?
2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol has a molecular weight of 216.40 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-6-trimethylsilylhex-5-ene-2,3-diol is sourced from PubChem (CID 175888077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).