C15H29NOSi — CID 175888646
tert-butyl-dimethyl-[(1-methyl-2,3,5,6-tetrahydro-1H-pyrrolizin-3-yl)methoxy]silane (PubChem CID 175888646) has the molecular formula C15H29NOSi and a molecular weight of 267.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1-methyl-2,3,5,6-tetrahydro-1H-pyrrolizin-3-yl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1-methyl-2,3,5,6-tetrahydro-1H-pyrrolizin-3-yl)methoxy]silane |
|---|---|
| PubChem CID | 175888646 |
| Molecular Formula | C15H29NOSi |
| Molecular Weight | 267.49 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | tert-butyl-dimethyl-[(1-methyl-2,3,5,6-tetrahydro-1H-pyrrolizin-3-yl)methoxy]silane |
| SMILES | CC1CC(CO[Si](C)(C)C(C)(C)C)N2CCC=C12 |
| InChI | InChI=1S/C15H29NOSi/c1-12-10-13(16-9-7-8-14(12)16)11-17-18(5,6)15(2,3)4/h8,12-13H,7,9-11H2,1-6H3 |
| InChIKey | VQMUSQWNOMSDKY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|