About 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine
1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine (PubChem CID 175888666) has the molecular formula C5H3F4N
and a molecular weight of 154.08 g/mol. Its IUPAC name is 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine.
Molecular Properties
| Compound Name | 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine |
| PubChem CID | 175888666 |
| Molecular Formula | C5H3F4N |
| Molecular Weight | 154.08 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine |
| SMILES | [2H]N1C=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C5H3F4N/c6-2-1-10-5(9)4(8)3(2)7/h1,5,10H/i/hD |
| InChIKey | SOXSUCZUWFLUCR-DYCDLGHISA-N |
| XLogP | 1.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.08 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine?
The IUPAC name of 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine (CID 175888666) is 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine.
What is the SMILES notation for 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine?
The canonical SMILES for 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine is [2H]N1C=C(F)C(F)=C(F)C1F.
What is the InChIKey of 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine?
The InChIKey is SOXSUCZUWFLUCR-DYCDLGHISA-N. The full InChI is InChI=1S/C5H3F4N/c6-2-1-10-5(9)4(8)3(2)7/h1,5,10H/i/hD.
What are the key properties of 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine?
1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine has a molecular weight of 154.08 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-2,3,4,5-tetrafluoro-2H-pyridine is sourced from PubChem (CID 175888666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).