About 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine
8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine (PubChem CID 175889784) has the molecular formula C17H20BrNO4
and a molecular weight of 382.25 g/mol. Its IUPAC name is 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine.
Molecular Properties
| Compound Name | 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine |
| PubChem CID | 175889784 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine |
| SMILES | CCNCC.COC(=O)c1cc2cccc(Br)c2cc1C(=O)O |
| InChI | InChI=1S/C13H9BrO4.C4H11N/c1-18-13(17)10-5-7-3-2-4-11(14)8(7)6-9(10)12(15)16;1-3-5-4-2/h2-6H,1H3,(H,15,16);5H,3-4H2,1-2H3 |
| InChIKey | LIOFWRITLGNFJR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine?
The IUPAC name of 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine (CID 175889784) is 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine.
What is the SMILES notation for 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine?
The canonical SMILES for 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine is CCNCC.COC(=O)c1cc2cccc(Br)c2cc1C(=O)O.
What is the InChIKey of 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine?
The InChIKey is LIOFWRITLGNFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO4.C4H11N/c1-18-13(17)10-5-7-3-2-4-11(14)8(7)6-9(10)12(15)16;1-3-5-4-2/h2-6H,1H3,(H,15,16);5H,3-4H2,1-2H3.
What are the key properties of 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine?
8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine has a molecular weight of 382.25 g/mol, XLogP of 3.70, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-methoxycarbonylnaphthalene-2-carboxylic acid;N-ethylethanamine is sourced from PubChem (CID 175889784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).