C14H13N3OS — CID 175890111
2-[(5R)-5-ethynylimidazolidin-1-yl]-7,8-dihydrofuro[3,2-e][1,3]benzothiazole (PubChem CID 175890111) has the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[(5R)-5-ethynylimidazolidin-1-yl]-7,8-dihydrofuro[3,2-e][1,3]benzothiazole.
| Compound Name | 2-[(5R)-5-ethynylimidazolidin-1-yl]-7,8-dihydrofuro[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 175890111 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[(5R)-5-ethynylimidazolidin-1-yl]-7,8-dihydrofuro[3,2-e][1,3]benzothiazole |
| SMILES | C#C[C@@H]1CNCN1c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C14H13N3OS/c1-2-9-7-15-8-17(9)14-16-13-10-5-6-18-11(10)3-4-12(13)19-14/h1,3-4,9,15H,5-8H2/t9-/m1/s1 |
| InChIKey | HZHNLUXBUVTDMF-SECBINFHSA-N |
| XLogP | 1.60 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|