C19H26ClN4O7P — CID 175890252
[[(2R,3S,4R,5S)-5-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid (PubChem CID 175890252) has the molecular formula C19H26ClN4O7P and a molecular weight of 488.87 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 175890252 |
| Molecular Formula | C19H26ClN4O7P |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-chloro-5H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]-methoxymethyl]phosphonic acid |
| SMILES | COC([C@@H]1O[C@@H](c2c[nH]c3c(N4CC5CCCC5C4)nc(Cl)nc23)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C19H26ClN4O7P/c1-30-18(32(27,28)29)16-14(26)13(25)15(31-16)10-5-21-12-11(10)22-19(20)23-17(12)24-6-8-3-2-4-9(8)7-24/h5,8-9,13-16,18,21,25-26H,2-4,6-7H2,1H3,(H2,27,28,29)/t8?,9?,13-,14+,15+,16-,18?/m1/s1 |
| InChIKey | LUEQKGFQEZWAIR-PXOHFUOHSA-N |
| XLogP | 1.16 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|