About 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one
2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one (PubChem CID 175890275) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one.
Analyze 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one?
The IUPAC name of 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one (CID 175890275) is 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one.
What is the SMILES notation for 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one?
The canonical SMILES for 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one is O=C1OC2OCCC3C1=CC=C23.
What is the InChIKey of 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one?
The InChIKey is PKZJIYOPZIBRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-8-6-1-2-7-5(6)3-4-11-9(7)12-8/h1-2,5,9H,3-4H2.
What are the key properties of 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one?
2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one has a molecular weight of 164.16 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,11-dioxatricyclo[5.4.0.04,8]undeca-4,6-dien-3-one is sourced from PubChem (CID 175890275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).