C23H29F3N4O6 — CID 175890584
(3S)-N-[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175890584) has the molecular formula C23H29F3N4O6 and a molecular weight of 514.50 g/mol. Its IUPAC name is (3S)-N-[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3S)-N-[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175890584 |
| Molecular Formula | C23H29F3N4O6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | (3S)-N-[(2S)-4-(cyclopropylamino)-3-hydroxy-4-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC1CC1)C(O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@@H]1Cc2ccccc2CN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N4O4.C2HF3O2/c26-18(21(29)24-15-5-6-15)16(10-13-7-8-22-19(13)27)25-20(28)17-9-12-3-1-2-4-14(12)11-23-17;3-2(4,5)1(6)7/h1-4,13,15-18,23,26H,5-11H2,(H,22,27)(H,24,29)(H,25,28);(H,6,7)/t13-,16-,17-,18?;/m0./s1 |
| InChIKey | UDCHDULEFXWTSV-LOZBVDTCSA-N |
| XLogP | -0.02 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |