C21H25Cl2N3O2 — CID 175891171
3-butan-2-yl-2-(4,6-dichloro-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175891171) has the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 3-butan-2-yl-2-(4,6-dichloro-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 3-butan-2-yl-2-(4,6-dichloro-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175891171 |
| Molecular Formula | C21H25Cl2N3O2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-butan-2-yl-2-(4,6-dichloro-1H-indole-2-carbonyl)-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CCC(C)C1(C(N)=O)C2CCCC2CN1C(=O)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c1-3-11(2)21(20(24)28)15-6-4-5-12(15)10-26(21)19(27)18-9-14-16(23)7-13(22)8-17(14)25-18/h7-9,11-12,15,25H,3-6,10H2,1-2H3,(H2,24,28) |
| InChIKey | OWGRRDROZVPHDG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |