About dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate
dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (PubChem CID 175891369) has the molecular formula C15H22O5
and a molecular weight of 282.34 g/mol. Its IUPAC name is dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| PubChem CID | 175891369 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2OC1CC2CC(C)(C)C |
| InChI | InChI=1S/C15H22O5/c1-15(2,3)7-8-6-9-10(13(16)18-4)11(12(8)20-9)14(17)19-5/h8-9,12H,6-7H2,1-5H3 |
| InChIKey | WMWBLFOAQZFDGU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The IUPAC name of dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (CID 175891369) is dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The canonical SMILES for dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)C2OC1CC2CC(C)(C)C.
What is the InChIKey of dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
The InChIKey is WMWBLFOAQZFDGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O5/c1-15(2,3)7-8-6-9-10(13(16)18-4)11(12(8)20-9)14(17)19-5/h8-9,12H,6-7H2,1-5H3.
What are the key properties of dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate?
dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate has a molecular weight of 282.34 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-(2,2-dimethylpropyl)-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate is sourced from PubChem (CID 175891369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).