About 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole
1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole (PubChem CID 175891520) has the molecular formula C12H20N2O
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole |
| PubChem CID | 175891520 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole |
| SMILES | [2H]n1nc(C)c(C2CC(C)OC(C)C2)c1C |
| InChI | InChI=1S/C12H20N2O/c1-7-5-11(6-8(2)15-7)12-9(3)13-14-10(12)4/h7-8,11H,5-6H2,1-4H3,(H,13,14)/i/hD |
| InChIKey | ZVABCTGQJKIIOJ-DYCDLGHISA-N |
| XLogP | 2.70 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole?
The IUPAC name of 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole (CID 175891520) is 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole.
What is the SMILES notation for 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole?
The canonical SMILES for 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole is [2H]n1nc(C)c(C2CC(C)OC(C)C2)c1C.
What is the InChIKey of 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole?
The InChIKey is ZVABCTGQJKIIOJ-DYCDLGHISA-N. The full InChI is InChI=1S/C12H20N2O/c1-7-5-11(6-8(2)15-7)12-9(3)13-14-10(12)4/h7-8,11H,5-6H2,1-4H3,(H,13,14)/i/hD.
What are the key properties of 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole?
1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole has a molecular weight of 209.31 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-4-(2,6-dimethyloxan-4-yl)-3,5-dimethylpyrazole is sourced from PubChem (CID 175891520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).