About cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride
cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride (PubChem CID 175891524) has the molecular formula C6H12Cl2F3NO
and a molecular weight of 242.07 g/mol. Its IUPAC name is cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride |
| PubChem CID | 175891524 |
| Molecular Formula | C6H12Cl2F3NO |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1CC[C@H](OC(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3NO.2ClH/c7-6(8,9)11-5-2-1-4(10)3-5;;/h4-5H,1-3,10H2;2*1H/t4-,5+;;/m1../s1 |
| InChIKey | DZMYEVFUSSRRHL-CIFXRNLBSA-N |
| XLogP | 2.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride?
The IUPAC name of cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride (CID 175891524) is cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride.
What is the SMILES notation for cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride?
The canonical SMILES for cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride is Cl.Cl.N[C@@H]1CC[C@H](OC(F)(F)F)C1.
What is the InChIKey of cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride?
The InChIKey is DZMYEVFUSSRRHL-CIFXRNLBSA-N. The full InChI is InChI=1S/C6H10F3NO.2ClH/c7-6(8,9)11-5-2-1-4(10)3-5;;/h4-5H,1-3,10H2;2*1H/t4-,5+;;/m1../s1.
What are the key properties of cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride?
cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride has a molecular weight of 242.07 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-(trifluoromethoxy)cyclopentan-1-amine;dihydrochloride is sourced from PubChem (CID 175891524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).