(1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate

C3H2F4O4 — CID 175891871

IUPAC(1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate
SMILESO=C(O)OC(F)(F)C(O)(F)F
InChIInChI=1S/C3H2F4O4/c4-2(5,10)3(6,7)11-1(8)9/h10H,(H,8,9)
InChIKeyUFYCGTHRSPRWJH-UHFFFAOYSA-N
MW178.04 g/mol
LogP0.86
Rot. Bonds2

About (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate

(1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate (PubChem CID 175891871) has the molecular formula C3H2F4O4 and a molecular weight of 178.04 g/mol. Its IUPAC name is (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate.

Molecular Properties

Compound Name(1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate
PubChem CID175891871
Molecular FormulaC3H2F4O4
Molecular Weight178.04 g/mol
Exact Mass177.99
IUPAC Name(1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate
SMILESO=C(O)OC(F)(F)C(O)(F)F
InChIInChI=1S/C3H2F4O4/c4-2(5,10)3(6,7)11-1(8)9/h10H,(H,8,9)
InChIKeyUFYCGTHRSPRWJH-UHFFFAOYSA-N
XLogP0.86
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.04
LogP ≤ 50.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate?
The IUPAC name of (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate (CID 175891871) is (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate.
What is the SMILES notation for (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate?
The canonical SMILES for (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate is O=C(O)OC(F)(F)C(O)(F)F.
What is the InChIKey of (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate?
The InChIKey is UFYCGTHRSPRWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2F4O4/c4-2(5,10)3(6,7)11-1(8)9/h10H,(H,8,9).
What are the key properties of (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate?
(1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate has a molecular weight of 178.04 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1,2,2-tetrafluoro-2-hydroxyethyl) hydrogen carbonate is sourced from PubChem (CID 175891871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).