C30H25F2N5O6S — CID 175892133
1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[5-(oxetan-3-yloxy)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 175892133) has the molecular formula C30H25F2N5O6S and a molecular weight of 621.62 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[5-(oxetan-3-yloxy)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[5-(oxetan-3-yloxy)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175892133 |
| Molecular Formula | C30H25F2N5O6S |
| Molecular Weight | 621.62 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[5-(oxetan-3-yloxy)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN(C)Cc1c(-c2ccc([N+](=O)[O-])cc2)sc2c1c(=O)n(-c1ccc(OC3COC3)cn1)c(=O)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C30H25F2N5O6S/c1-34(2)13-22-26-28(38)36(25-11-10-19(12-33-25)43-20-15-42-16-20)30(39)35(14-21-23(31)4-3-5-24(21)32)29(26)44-27(22)17-6-8-18(9-7-17)37(40)41/h3-12,20H,13-16H2,1-2H3 |
| InChIKey | KCJVFLDLNQWJOI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 121.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|