C29H24F2N6O6S — CID 175892324
1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(oxetan-3-yloxy)pyridazin-3-yl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 175892324) has the molecular formula C29H24F2N6O6S and a molecular weight of 622.61 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(oxetan-3-yloxy)pyridazin-3-yl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(oxetan-3-yloxy)pyridazin-3-yl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175892324 |
| Molecular Formula | C29H24F2N6O6S |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)-3-[6-(oxetan-3-yloxy)pyridazin-3-yl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN(C)Cc1c(-c2ccc([N+](=O)[O-])cc2)sc2c1c(=O)n(-c1ccc(OC3COC3)nn1)c(=O)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C29H24F2N6O6S/c1-34(2)12-20-25-27(38)36(23-10-11-24(33-32-23)43-18-14-42-15-18)29(39)35(13-19-21(30)4-3-5-22(19)31)28(25)44-26(20)16-6-8-17(9-7-16)37(40)41/h3-11,18H,12-15H2,1-2H3 |
| InChIKey | CGWGPPQNDOBJOZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 134.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|