C7H10N2O3S — CID 175892536
6-(1-hydroxyethyl)pyridine-2-sulfonamide (PubChem CID 175892536) has the molecular formula C7H10N2O3S and a molecular weight of 202.24 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)pyridine-2-sulfonamide.
| Compound Name | 6-(1-hydroxyethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 175892536 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 6-(1-hydroxyethyl)pyridine-2-sulfonamide |
| SMILES | CC(O)c1cccc(S(N)(=O)=O)n1 |
| InChI | InChI=1S/C7H10N2O3S/c1-5(10)6-3-2-4-7(9-6)13(8,11)12/h2-5,10H,1H3,(H2,8,11,12) |
| InChIKey | LUCCLHVONJBFAI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |