C23H18Na2O6S2 — CID 175893020
disodium;3-methyl-2-[(3-methyl-1-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate (PubChem CID 175893020) has the molecular formula C23H18Na2O6S2 and a molecular weight of 500.51 g/mol. Its IUPAC name is disodium;3-methyl-2-[(3-methyl-1-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate.
| Compound Name | disodium;3-methyl-2-[(3-methyl-1-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 175893020 |
| Molecular Formula | C23H18Na2O6S2 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | disodium;3-methyl-2-[(3-methyl-1-sulfonatonaphthalen-2-yl)methyl]naphthalene-1-sulfonate |
| SMILES | Cc1cc2ccccc2c(S(=O)(=O)[O-])c1Cc1c(C)cc2ccccc2c1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C23H20O6S2.2Na/c1-14-11-16-7-3-5-9-18(16)22(30(24,25)26)20(14)13-21-15(2)12-17-8-4-6-10-19(17)23(21)31(27,28)29;;/h3-12H,13H2,1-2H3,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | AVKKBSOPJRVEFF-UHFFFAOYSA-L |
| XLogP | -1.98 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|