About bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium
bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium (PubChem CID 175893047) has the molecular formula C18H30HfSi2-2
and a molecular weight of 481.10 g/mol. Its IUPAC name is bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium.
Molecular Properties
| Compound Name | bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium |
| PubChem CID | 175893047 |
| Molecular Formula | C18H30HfSi2-2 |
| Molecular Weight | 481.10 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium |
| SMILES | C[Si](C)(C)Cc1ccc[cH-]1.C[Si](C)(C)Cc1ccc[cH-]1.[Hf] |
| InChI | InChI=1S/2C9H15Si.Hf/c2*1-10(2,3)8-9-6-4-5-7-9;/h2*4-7H,8H2,1-3H3;/q2*-1; |
| InChIKey | AZHWXRGPQSWHPM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.10 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium?
The IUPAC name of bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium (CID 175893047) is bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium.
What is the SMILES notation for bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium?
The canonical SMILES for bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium is C[Si](C)(C)Cc1ccc[cH-]1.C[Si](C)(C)Cc1ccc[cH-]1.[Hf].
What is the InChIKey of bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium?
The InChIKey is AZHWXRGPQSWHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H15Si.Hf/c2*1-10(2,3)8-9-6-4-5-7-9;/h2*4-7H,8H2,1-3H3;/q2*-1;.
What are the key properties of bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium?
bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium has a molecular weight of 481.10 g/mol, XLogP of 5.65, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-1,3-dien-1-ylmethyl(trimethyl)silane);hafnium is sourced from PubChem (CID 175893047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).