About (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid
(7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid (PubChem CID 175893139) has the molecular formula C8H8BFO4
and a molecular weight of 197.96 g/mol. Its IUPAC name is (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid.
Molecular Properties
| Compound Name | (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid |
| PubChem CID | 175893139 |
| Molecular Formula | C8H8BFO4 |
| Molecular Weight | 197.96 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid |
| SMILES | OB(O)Oc1cc(F)c2c(c1)COC2 |
| InChI | InChI=1S/C8H8BFO4/c10-8-2-6(14-9(11)12)1-5-3-13-4-7(5)8/h1-2,11-12H,3-4H2 |
| InChIKey | VZCFAUTTYNWBPH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.96 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid?
The IUPAC name of (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid (CID 175893139) is (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid.
What is the SMILES notation for (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid?
The canonical SMILES for (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid is OB(O)Oc1cc(F)c2c(c1)COC2.
What is the InChIKey of (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid?
The InChIKey is VZCFAUTTYNWBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BFO4/c10-8-2-6(14-9(11)12)1-5-3-13-4-7(5)8/h1-2,11-12H,3-4H2.
What are the key properties of (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid?
(7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid has a molecular weight of 197.96 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-1,3-dihydro-2-benzofuran-5-yl)oxyboronic acid is sourced from PubChem (CID 175893139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).