C27H28N6O3 — CID 175894022
methyl 3-methyl-2-[(2R,5R,7R,9E)-2-methyl-4-oxo-3,13,19-triazatetracyclo[11.5.2.05,7.016,20]icosa-1(19),9,14,16(20),17-pentaen-14-yl]imidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 175894022) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is methyl 3-methyl-2-[(2R,5R,7R,9E)-2-methyl-4-oxo-3,13,19-triazatetracyclo[11.5.2.05,7.016,20]icosa-1(19),9,14,16(20),17-pentaen-14-yl]imidazo[4,5-b]pyridine-6-carboxylate.
| Compound Name | methyl 3-methyl-2-[(2R,5R,7R,9E)-2-methyl-4-oxo-3,13,19-triazatetracyclo[11.5.2.05,7.016,20]icosa-1(19),9,14,16(20),17-pentaen-14-yl]imidazo[4,5-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 175894022 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | methyl 3-methyl-2-[(2R,5R,7R,9E)-2-methyl-4-oxo-3,13,19-triazatetracyclo[11.5.2.05,7.016,20]icosa-1(19),9,14,16(20),17-pentaen-14-yl]imidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)nc(-c1cc3ccc4nc3n1CC/C=C/C[C@@H]1C[C@H]1C(=O)N[C@@H]4C)n2C |
| InChI | InChI=1S/C27H28N6O3/c1-15-20-9-8-17-13-22(25-31-21-12-18(27(35)36-3)14-28-24(21)32(25)2)33(23(17)30-20)10-6-4-5-7-16-11-19(16)26(34)29-15/h4-5,8-9,12-16,19H,6-7,10-11H2,1-3H3,(H,29,34)/b5-4+/t15-,16-,19-/m1/s1 |
| InChIKey | QHHSGEAHYOUHCH-LWULACIOSA-N |
| XLogP | 3.93 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|