C9H9F3N2 — CID 175894186
2-(2,2,2-trifluoroethyl)-5,6-dihydro-1H-benzimidazole (PubChem CID 175894186) has the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-5,6-dihydro-1H-benzimidazole.
| Compound Name | 2-(2,2,2-trifluoroethyl)-5,6-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 175894186 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-5,6-dihydro-1H-benzimidazole |
| SMILES | FC(F)(F)Cc1nc2c([nH]1)=CCCC=2 |
| InChI | InChI=1S/C9H9F3N2/c10-9(11,12)5-8-13-6-3-1-2-4-7(6)14-8/h3-4H,1-2,5H2,(H,13,14) |
| InChIKey | ISXVINNPNJDENL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |