C26H41N3Zr — CID 175894662
N-[2-(2,3,4,5,6-pentamethylanilino)ethyl]-N'-(2,3,4,5,6-pentamethylphenyl)ethane-1,2-diamine;zirconium (PubChem CID 175894662) has the molecular formula C26H41N3Zr and a molecular weight of 486.86 g/mol. Its IUPAC name is N-[2-(2,3,4,5,6-pentamethylanilino)ethyl]-N'-(2,3,4,5,6-pentamethylphenyl)ethane-1,2-diamine;zirconium.
| Compound Name | N-[2-(2,3,4,5,6-pentamethylanilino)ethyl]-N'-(2,3,4,5,6-pentamethylphenyl)ethane-1,2-diamine;zirconium |
|---|---|
| PubChem CID | 175894662 |
| Molecular Formula | C26H41N3Zr |
| Molecular Weight | 486.86 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[2-(2,3,4,5,6-pentamethylanilino)ethyl]-N'-(2,3,4,5,6-pentamethylphenyl)ethane-1,2-diamine;zirconium |
| SMILES | Cc1c(C)c(C)c(NCCNCCNc2c(C)c(C)c(C)c(C)c2C)c(C)c1C.[Zr] |
| InChI | InChI=1S/C26H41N3.Zr/c1-15-17(3)21(7)25(22(8)18(15)4)28-13-11-27-12-14-29-26-23(9)19(5)16(2)20(6)24(26)10;/h27-29H,11-14H2,1-10H3; |
| InChIKey | OYMBMHZKHVXDPI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.86 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|