C22H22F3N5O — CID 175895161
N-[3-[(4-aminophenyl)-(cyclopropylmethylamino)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 175895161) has the molecular formula C22H22F3N5O and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[3-[(4-aminophenyl)-(cyclopropylmethylamino)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-[(4-aminophenyl)-(cyclopropylmethylamino)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175895161 |
| Molecular Formula | C22H22F3N5O |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[3-[(4-aminophenyl)-(cyclopropylmethylamino)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Nc1ccc(C(NCC2CC2)c2cccc(NC(=O)c3cc(C(F)(F)F)[nH]n3)c2)cc1 |
| InChI | InChI=1S/C22H22F3N5O/c23-22(24,25)19-11-18(29-30-19)21(31)28-17-3-1-2-15(10-17)20(27-12-13-4-5-13)14-6-8-16(26)9-7-14/h1-3,6-11,13,20,27H,4-5,12,26H2,(H,28,31)(H,29,30) |
| InChIKey | VHODISOEXBOKDB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|