C11H11F5N2S — CID 175895292
N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfanyl)benzenecarboximidamide (PubChem CID 175895292) has the molecular formula C11H11F5N2S and a molecular weight of 298.28 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfanyl)benzenecarboximidamide.
| Compound Name | N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 175895292 |
| Molecular Formula | C11H11F5N2S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(/c1cccc(SC(F)(F)C(F)(F)F)c1)N(C)C |
| InChI | InChI=1S/C11H11F5N2S/c1-18(2)9(17)7-4-3-5-8(6-7)19-11(15,16)10(12,13)14/h3-6,17H,1-2H3/b17-9- |
| InChIKey | UNANTAPZAXJZMG-MFOYZWKCSA-N |
| XLogP | 3.82 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|