About 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide
3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide (PubChem CID 175895695) has the molecular formula C8H11N5O2
and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide.
Molecular Properties
| Compound Name | 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide |
| PubChem CID | 175895695 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide |
| SMILES | NC(=O)c1cnc(N2CC[C@@H](O)C2)nn1 |
| InChI | InChI=1S/C8H11N5O2/c9-7(15)6-3-10-8(12-11-6)13-2-1-5(14)4-13/h3,5,14H,1-2,4H2,(H2,9,15)/t5-/m1/s1 |
| InChIKey | VHIMEJVGUKQNLG-RXMQYKEDSA-N |
| XLogP | -1.46 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide?
The IUPAC name of 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide (CID 175895695) is 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide.
What is the SMILES notation for 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide?
The canonical SMILES for 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide is NC(=O)c1cnc(N2CC[C@@H](O)C2)nn1.
What is the InChIKey of 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide?
The InChIKey is VHIMEJVGUKQNLG-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H11N5O2/c9-7(15)6-3-10-8(12-11-6)13-2-1-5(14)4-13/h3,5,14H,1-2,4H2,(H2,9,15)/t5-/m1/s1.
What are the key properties of 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide?
3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide has a molecular weight of 209.21 g/mol, XLogP of -1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-3-hydroxypyrrolidin-1-yl]-1,2,4-triazine-6-carboxamide is sourced from PubChem (CID 175895695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).