C23H25LiN5O3 — CID 175896370
CID 175896370 (PubChem CID 175896370) has the molecular formula C23H25LiN5O3 and a molecular weight of 426.43 g/mol.
| Compound Name | CID 175896370 |
|---|---|
| PubChem CID | 175896370 |
| Molecular Formula | C23H25LiN5O3 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cc(Nc3ccncc3)c3c(n2)N(C(=O)OC(C)(C)C)CCO3)n1.[Li] |
| InChI | InChI=1S/C23H25N5O3.Li/c1-15-6-5-7-17(25-15)18-14-19(26-16-8-10-24-11-9-16)20-21(27-18)28(12-13-30-20)22(29)31-23(2,3)4;/h5-11,14H,12-13H2,1-4H3,(H,24,26,27); |
| InChIKey | RIUGLTZCWQMXJJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |