C18H18F3N3O5S2 — CID 175896892
benzyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate (PubChem CID 175896892) has the molecular formula C18H18F3N3O5S2 and a molecular weight of 477.49 g/mol. Its IUPAC name is benzyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate.
| Compound Name | benzyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate |
|---|---|
| PubChem CID | 175896892 |
| Molecular Formula | C18H18F3N3O5S2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | benzyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCCN(C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C18H18F3N3O5S2/c1-30-16-22-14-10-24(17(25)28-11-12-6-3-2-4-7-12)9-5-8-13(14)15(23-16)29-31(26,27)18(19,20)21/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | KHNKNQZVVOBNLX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|